| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:06:55 UTC |
|---|
| Update Date | 2025-03-25 00:56:16 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02217312 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18O8 |
|---|
| Molecular Mass | 314.1002 |
|---|
| SMILES | COC(=O)C1=CC(OC(C)=O)C(OC(C)=O)C(OC(C)=O)C1 |
|---|
| InChI Key | OUBBYDNGQLDKMI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tetracarboxylic acids and derivatives |
|---|
| Direct Parent | tetracarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscyclitols and derivativesenoate estershydrocarbon derivativesmethyl estersorganic oxides |
|---|
| Substituents | enoate estercarbonyl groupcyclitol or derivativestetracarboxylic acid or derivativesalpha,beta-unsaturated carboxylic esterorganic oxidemethyl esterorganic oxygen compoundcarboxylic acid esteraliphatic homomonocyclic compoundhydrocarbon derivativeorganooxygen compound |
|---|