| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:06:55 UTC |
|---|
| Update Date | 2025-03-25 00:56:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02217331 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H17NO3 |
|---|
| Molecular Mass | 211.1208 |
|---|
| SMILES | C=CC1(O)CN(C(=O)OC)C2CCCC21 |
|---|
| InChI Key | YNZCQBOVJXTCBB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrrolidines |
|---|
| Subclass | pyrrolidine carboxylic acids and derivatives |
|---|
| Direct Parent | pyrrolidine carboxylic acids |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundscarbonyl compoundshydrocarbon derivativesmethylcarbamatesorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundstertiary alcohols |
|---|
| Substituents | alcoholcarbonyl groupcarbonic acid derivativeazacyclemethylcarbamatecarbamic acid esteraliphatic heteropolycyclic compoundtertiary alcoholorganic oxideorganic oxygen compoundpyrrolidine carboxylic acidorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|