| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:06:56 UTC |
|---|
| Update Date | 2025-03-25 00:56:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02217384 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C7H17N2O4S+ |
|---|
| Molecular Mass | 225.0904 |
|---|
| SMILES | C[N+](C)(C)C(O)=NCCCS(=O)(=O)O |
|---|
| InChI Key | QVCJRPIGIZUYNM-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfonic acids and derivatives |
|---|
| Subclass | organosulfonic acids and derivatives |
|---|
| Direct Parent | organosulfonic acids |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carboximidamideshydrocarbon derivativesorganic cationsorganic oxidesorganooxygen compoundsorganopnictogen compoundssulfonyls |
|---|
| Substituents | aliphatic acyclic compoundorganosulfonic acidcarboximidamideorganosulfur compoundorganic oxidesulfonylorganic oxygen compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganooxygen compound |
|---|