| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:06:58 UTC |
|---|
| Update Date | 2025-03-25 00:56:17 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02217434 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H21NO3S |
|---|
| Molecular Mass | 283.1242 |
|---|
| SMILES | CCCN(CCC)S(=O)c1ccc(C(=O)OC)cc1 |
|---|
| InChI Key | ZZUICKRFLCJBSI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | p-sulfanylbenzoic acids and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | aminosulfinyl compoundsbenzoic acid estersbenzoyl derivativeshydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundssulfinic acids and derivatives |
|---|
| Substituents | sulfinic acid derivativebenzoylbenzoate esterorganosulfur compoundcarboxylic acid derivativearomatic homomonocyclic compoundaminosulfinyl compoundorganic oxidemonocarboxylic acid or derivativesmethyl esterorganic oxygen compoundsulfinyl compoundp-sulfanylbenzoic acid or derivativescarboxylic acid esterorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|