| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:00 UTC |
|---|
| Update Date | 2025-03-25 00:56:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02217538 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H19NO2 |
|---|
| Molecular Mass | 233.1416 |
|---|
| SMILES | CC1CC(Cc2cccc(O)c2)C(=O)N(C)C1 |
|---|
| InChI Key | LIOCSNMNMHMLJV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | piperidines |
|---|
| Subclass | benzylpiperidines |
|---|
| Direct Parent | 3-benzylpiperidines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativescarbonyl compoundscarboxylic acids and derivativesdelta lactamshydrocarbon derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspiperidinonestertiary carboxylic acid amides |
|---|
| Substituents | monocyclic benzene moietycarbonyl grouplactamaromatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivative3-benzylpiperidineorganic oxidetertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpiperidinoneazacycle1-hydroxy-4-unsubstituted benzenoidcarboxamide groupdelta-lactamorganic oxygen compoundphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compound |
|---|
