| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:00 UTC |
|---|
| Update Date | 2025-03-25 00:56:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02217541 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H18NO11P |
|---|
| Molecular Mass | 407.0617 |
|---|
| SMILES | O=C1Nc2ccccc2OC1OC1C(O)OC(COP(=O)(O)O)C(O)C1O |
|---|
| InChI Key | MWCSWUAZNOFZEK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | hexose phosphates |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diolsacetalsazacyclic compoundsbenzenoidsbenzomorpholinesbenzoxazinonescarbonyl compoundscarboxylic acids and derivativeshemiacetalshydrocarbon derivativeslactamsmonoalkyl phosphatesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanessecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | carbonyl grouplactamcarboxylic acid derivativebenzomorpholineorganic oxideacetalaromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundhemiacetaloxaneorganoheterocyclic compound1,2-diolalcoholazacyclebenzoxazinecarboxamide groupoxazinaneoxacyclesecondary carboxylic acid amidemorpholinebenzoxazinonephosphoric acid estermonoalkyl phosphatesecondary alcoholhexose phosphatehydrocarbon derivativebenzenoidorganic nitrogen compoundorganic phosphoric acid derivativealkyl phosphate |
|---|
