| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:01 UTC |
|---|
| Update Date | 2025-03-25 00:56:18 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02217550 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H23NO10 |
|---|
| Molecular Mass | 401.1322 |
|---|
| SMILES | CC(=O)NC1C(O)C(O)C(Oc2ccccc2C(=O)O)OC1C(O)C(O)CO |
|---|
| InChI Key | HKSQZQWSIADIJC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | benzoic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsacetalsacetamidesbenzoyl derivativescarbonyl compoundshydrocarbon derivativesmonocarboxylic acids and derivativesmonosaccharidesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsoxacyclic compoundsoxanesphenol ethersphenoxy compoundsprimary alcoholssecondary alcoholssecondary carboxylic acid amides |
|---|
| Substituents | phenol ethercarbonyl groupcarboxylic acidaromatic heteromonocyclic compoundbenzoylmonosaccharidecarboxylic acid derivativesaccharideorganic oxideacetalorganonitrogen compoundorganopnictogen compound1-carboxy-2-haloaromatic compoundbenzoic acidoxaneprimary alcoholorganoheterocyclic compoundacetamidealcoholcarboxamide groupoxacyclesecondary carboxylic acid amidemonocarboxylic acid or derivativesorganic oxygen compoundsecondary alcoholhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
