| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:04 UTC |
|---|
| Update Date | 2025-03-25 00:56:19 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02217685 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H28O11 |
|---|
| Molecular Mass | 420.1632 |
|---|
| SMILES | CC1OC(OCOC(C(O)CO)C(O)Cc2ccc(O)c(O)c2)C(O)C(O)C1O |
|---|
| InChI Key | GUFCREQNBLCNMV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty alcohols |
|---|
| Direct Parent | fatty alcohols |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsacetalsbenzene and substituted derivativeshydrocarbon derivativesmonosaccharidesoxacyclic compoundsoxanesprimary alcoholssecondary alcohols |
|---|
| Substituents | alcoholmonocyclic benzene moietyaromatic heteromonocyclic compound1-hydroxy-2-unsubstituted benzenoidmonosaccharide1-hydroxy-4-unsubstituted benzenoidoxacyclesaccharideorganic oxygen compoundacetalfatty alcoholsecondary alcoholphenolhydrocarbon derivativebenzenoidoxaneprimary alcoholorganoheterocyclic compoundorganooxygen compound |
|---|