| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:07 UTC |
|---|
| Update Date | 2025-03-25 00:56:21 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02217808 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H26N2O6 |
|---|
| Molecular Mass | 378.1791 |
|---|
| SMILES | COc1cc(C=CC(=O)CC(NC(=O)C(N)CC(C)C)C(=O)O)ccc1O |
|---|
| InChI Key | PAIPIVDYFULFLV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | dipeptides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacryloyl compoundsalkyl aryl ethersalpha amino acid amidesalpha amino acidsamino fatty acidsanisolesbranched fatty acidscarbocyclic fatty acidscarboxylic acidsenonesgamma-keto acids and derivativeshydrocarbon derivativeshydroxy fatty acidshydroxycinnamic acidsketonesleucine and derivativesmedium-chain keto acids and derivativesmethoxybenzenesmethoxyphenolsmonoalkylaminesmonocarboxylic acids and derivativesn-acyl aminesn-acyl-alpha amino acidsorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundssecondary carboxylic acid amides |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarboxylic acidmethoxyphenolalpha-amino acid or derivativesalpha,beta-unsaturated ketoneketoneorganonitrogen compoundalpha-amino acidhydroxy fatty acidn-acyl-alpha amino acid or derivativesalpha-amino acid amiden-acyl-alpha-amino acidmethoxybenzenebranched fatty acidaromatic homomonocyclic compoundalpha-dipeptidesecondary carboxylic acid amideanisoleketo acidphenolhydrocarbon derivativeacryloyl-groupprimary aliphatic aminephenoxy compoundmedium-chain keto acidfatty acylcarbocyclic fatty acidcarbonyl groupetherfatty amide1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherhydroxycinnamic acid or derivativescinnamic acid or derivativesorganic oxideleucine or derivativesorganopnictogen compoundenonecarboxamide groupamino fatty acidn-acyl-aminehydroxycinnamic acidgamma-keto acidmonocarboxylic acid or derivativesorganic oxygen compoundbenzenoidorganic nitrogen compoundorganooxygen compound |
|---|