| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:11 UTC |
|---|
| Update Date | 2025-03-25 00:56:22 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02217949 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H16N2O2 |
|---|
| Molecular Mass | 256.1212 |
|---|
| SMILES | Oc1ccc(C2NC(c3cccnc3)CC2O)cc1 |
|---|
| InChI Key | GVSDGPSLIPOMOJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyridines and derivatives |
|---|
| Subclass | pyrrolidinylpyridines |
|---|
| Direct Parent | pyrrolidinylpyridines |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsazacyclic compoundsbenzene and substituted derivativesdialkylaminesheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesorganopnictogen compoundsphenylpyrrolidinespyrrolessecondary alcohols |
|---|
| Substituents | monocyclic benzene moietyaromatic heteromonocyclic compoundpyrrolidinylpyridine1-hydroxy-2-unsubstituted benzenoidorganonitrogen compoundorganopnictogen compoundpyrrolidinealcoholsecondary aliphatic amineazacycle2-phenylpyrrolidineheteroaromatic compoundhydroxypyridinesecondary amineorganic oxygen compoundpyrrolesecondary alcoholphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundamine |
|---|
