| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:13 UTC |
|---|
| Update Date | 2025-03-25 00:56:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02218009 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C21H24O7 |
|---|
| Molecular Mass | 388.1522 |
|---|
| SMILES | Cc1ccc(C(C)c2ccc(OC3OC(C(=O)O)C(O)C(O)C3O)cc2)cc1 |
|---|
| InChI Key | ZEEZWCUROHTDBP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | carbohydrates and carbohydrate conjugates |
|---|
| Direct Parent | o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalsaromatic monoterpenoidsbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidsdiphenylmethanesglucuronic acid derivativeshydrocarbon derivativesmonocarboxylic acids and derivativesmonocyclic monoterpenoidsmonosaccharidesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundspyran carboxylic acidssecondary alcoholstoluenes |
|---|
| Substituents | diphenylmethanemonoterpenoidphenol ethermonocyclic benzene moietycarbonyl groupmonocyclic monoterpenoidcarboxylic acidaromatic heteromonocyclic compoundo-glucuronidemonosaccharidep-cymenecarboxylic acid derivativepyran carboxylic acid1-o-glucuronidebeta-hydroxy acidorganic oxideacetaloxaneorganoheterocyclic compoundalcoholpyran carboxylic acid or derivativeshydroxy acidoxacyclemonocarboxylic acid or derivativespyransecondary alcoholhydrocarbon derivativebenzenoidphenoxy compoundtoluenearomatic monoterpenoid |
|---|