| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:14 UTC |
|---|
| Update Date | 2025-03-25 00:56:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02218070 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H18O4 |
|---|
| Molecular Mass | 214.1205 |
|---|
| SMILES | COC(=O)C1C(O)CC2CC1(O)C2(C)C |
|---|
| InChI Key | PIXCUTJTHHSQFY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | monoterpenoids |
|---|
| Direct Parent | bicyclic monoterpenoids |
|---|
| Geometric Descriptor | aliphatic homopolycyclic compounds |
|---|
| Alternative Parents | beta hydroxy acids and derivativescarbonyl compoundscyclic alcohols and derivativeshydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesorganic oxidessecondary alcoholstertiary alcohols |
|---|
| Substituents | alcoholcarbonyl grouphydroxy acidcyclic alcoholcarboxylic acid derivativealiphatic homopolycyclic compoundpinane monoterpenoidbeta-hydroxy acidtertiary alcoholorganic oxidemonocarboxylic acid or derivativesmethyl esterorganic oxygen compoundcyclobutanolcarboxylic acid estersecondary alcoholhydrocarbon derivativebicyclic monoterpenoidorganooxygen compound |
|---|
