| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:15 UTC |
|---|
| Update Date | 2025-03-25 00:56:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02218099 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H14Cl2N4O2 |
|---|
| Molecular Mass | 400.0494 |
|---|
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(Cc3ccc(Cl)cc3Cl)c2cc1C |
|---|
| InChI Key | AFMZNZAEIGJEFY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pteridines and derivatives |
|---|
| Subclass | alloxazines and isoalloxazines |
|---|
| Direct Parent | flavins |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | aryl chloridesazacyclic compoundsdiazanaphthalenesdichlorobenzenesheteroaromatic compoundshydrocarbon derivativeslactamsorganic carbonic acids and derivativesorganic oxidesorganochloridesorganonitrogen compoundsorganooxygen compoundsorganopnictogen compoundspyrazinespyrimidonesquinoxalines |
|---|
| Substituents | monocyclic benzene moietylactamorganochloridepyrimidoneorganohalogen compoundflavinpyrimidine1,3-dichlorobenzeneorganic oxidediazanaphthalenearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compoundaryl chloridechlorobenzenequinoxalinecarbonic acid derivativeazacycleheteroaromatic compoundaryl halideorganic oxygen compoundpyrazinehydrocarbon derivativebenzenoidorganic nitrogen compoundhalobenzeneorganooxygen compound |
|---|
