| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:15 UTC |
|---|
| Update Date | 2025-03-25 00:56:23 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02218105 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H18Cl2N2O |
|---|
| Molecular Mass | 348.0796 |
|---|
| SMILES | CNC1CCC(c2ccc(Cl)c(Cl)c2)c2ccc(C(N)=O)cc21 |
|---|
| InChI Key | GIENPXSUZALJHK-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | tetralins |
|---|
| Subclass | tametralines |
|---|
| Direct Parent | tametralines |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | amino acids and derivativesaryl chloridescarboxylic acids and derivativesdialkylaminesdichlorobenzeneshydrocarbon derivativesnaphthalenecarboxamidesnaphthalenecarboxylic acidsorganic oxidesorganochloridesorganooxygen compoundsorganopnictogen compoundsprimary carboxylic acid amides |
|---|
| Substituents | primary carboxylic acid amidemonocyclic benzene moietyamino acid or derivativesorganochloridecarboxylic acid derivativeorganohalogen compoundorganic oxideorganonitrogen compoundorganopnictogen compound1,2-dichlorobenzenearyl chloridechlorobenzenesecondary aliphatic aminearomatic homopolycyclic compoundsecondary aminecarboxamide grouparyl halidetametraline2-naphthalenecarboxamideorganic oxygen compound2-naphthalenecarboxylic acid or derivativeshydrocarbon derivativeorganic nitrogen compound2-naphthalenecarboxylic acidhalobenzeneorganooxygen compoundamine |
|---|
