| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:18 UTC |
|---|
| Update Date | 2025-03-25 00:56:24 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02218218 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H20O8 |
|---|
| Molecular Mass | 304.1158 |
|---|
| SMILES | COC(=O)C1C(OC(C)=O)C(O)C(O)C2OC(C)(C)OC21 |
|---|
| InChI Key | BLUNKXFPDNKPGH-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | ethers |
|---|
| Direct Parent | ketals |
|---|
| Geometric Descriptor | aliphatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-diols1,3-dioxolanescarbonyl compoundscyclitols and derivativesdicarboxylic acids and derivativeshydrocarbon derivativesmethyl estersorganic oxidesoxacyclic compoundssecondary alcohols |
|---|
| Substituents | alcoholmeta-dioxolanecarbonyl groupcyclitol or derivativescyclic alcoholcarboxylic acid derivativealiphatic heteropolycyclic compoundoxacycleorganic oxidemethyl esterketalcarboxylic acid estersecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativeorganoheterocyclic compound1,2-diol |
|---|
