| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:20 UTC |
|---|
| Update Date | 2025-03-25 00:56:25 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02218310 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H16O |
|---|
| Molecular Mass | 236.1201 |
|---|
| SMILES | Cc1cccc(C)c1C(=O)C=Cc1ccccc1 |
|---|
| InChI Key | CTFQRPXEYMQLHQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | linear 1,3-diarylpropanoids |
|---|
| Direct Parent | linear 1,3-diarylpropanoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha,beta-unsaturated ketonesaryl ketonesbenzoyl derivativescinnamic acids and derivativeshydrocarbon derivativesorganic oxidesorganooxygen compoundsm-xylenes |
|---|
| Substituents | linear 1,3-diarylpropanoidmonocyclic benzene moietym-xylenebenzoylalpha,beta-unsaturated ketoneketonearomatic homomonocyclic compoundxylenecinnamic acid or derivativesorganic oxideorganic oxygen compoundhydrocarbon derivativebenzenoidorganooxygen compoundaryl ketone |
|---|
