| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:22 UTC |
|---|
| Update Date | 2025-03-25 00:56:26 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02218387 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H18N2O3 |
|---|
| Molecular Mass | 286.1317 |
|---|
| SMILES | Cc1cccc(C)c1NC(=O)Cn1c(C=O)ccc1CO |
|---|
| InChI Key | DGFNGUHEIRKOPR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | anilides |
|---|
| Direct Parent | anilides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aromatic alcoholsaryl-aldehydesazacyclic compoundscarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesn-arylamidesorganic oxidesorganopnictogen compoundssecondary carboxylic acid amidessubstituted pyrrolesm-xylenes |
|---|
| Substituents | aromatic alcoholcarbonyl grouparomatic heteromonocyclic compoundn-arylamidesubstituted pyrrolecarboxylic acid derivativexyleneorganic oxidearyl-aldehydeorganonitrogen compoundorganopnictogen compoundorganoheterocyclic compoundalcoholazacycleheteroaromatic compoundm-xylenealdehydecarboxamide groupanilidesecondary carboxylic acid amideorganic oxygen compoundpyrrolehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
