| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:24 UTC |
|---|
| Update Date | 2025-03-25 00:56:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02218453 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C13H22N+ |
|---|
| Molecular Mass | 192.1747 |
|---|
| SMILES | Cc1ccccc1CC(C)[N+](C)(C)C |
|---|
| InChI Key | YNHSBDSCSVRTLB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | phenethylamines |
|---|
| Direct Parent | amphetamines and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amineshydrocarbon derivativesorganic cationsorganic saltsorganopnictogen compoundsphenylpropanestetraalkylammonium saltstoluenes |
|---|
| Substituents | tetraalkylammonium saltquaternary ammonium saltphenylpropanearomatic homomonocyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic salttolueneamineamphetamine or derivatives |
|---|