| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:24 UTC |
|---|
| Update Date | 2025-03-25 00:56:27 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02218464 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H12N2O3S |
|---|
| Molecular Mass | 228.0569 |
|---|
| SMILES | CNc1ccc(S(=O)(=O)NC(C)=O)cc1 |
|---|
| InChI Key | LHDSSRMGFDEUPR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzenesulfonamides |
|---|
| Direct Parent | benzenesulfonamides |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | acetamidesamino acids and derivativesaminosulfonyl compoundsbenzenesulfonyl compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundsorganosulfonic acids and derivativesphenylalkylaminessecondary alkylarylamines |
|---|
| Substituents | organosulfonic acid or derivativescarbonyl groupamino acid or derivativesorganosulfur compoundcarboxylic acid derivativeorganic oxideorganonitrogen compoundorganopnictogen compoundacetamidebenzenesulfonyl groupbenzenesulfonamideaminosulfonyl compoundsecondary aminesecondary aliphatic/aromatic aminearomatic homomonocyclic compoundsulfonylorganic oxygen compoundorganic sulfonic acid or derivativesphenylalkylaminehydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|