| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:34 UTC |
|---|
| Update Date | 2025-03-25 00:56:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02218817 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C5H9N5O3S |
|---|
| Molecular Mass | 219.0426 |
|---|
| SMILES | Cn1c(N)c(S(N)(=O)=O)c(N)nc1=O |
|---|
| InChI Key | HLWXWPOMHMPMID-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazines |
|---|
| Subclass | pyrimidines and pyrimidine derivatives |
|---|
| Direct Parent | pyrimidones |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | aminosulfonyl compoundsazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesimidolactamsorganic carbonic acids and derivativesorganic oxidesorganooxygen compoundsorganopnictogen compoundsorganosulfonamidesprimary amines |
|---|
| Substituents | organosulfonic acid or derivativescarbonic acid derivativearomatic heteromonocyclic compoundazacycleaminosulfonyl compoundheteroaromatic compoundpyrimidoneorganosulfur compoundorganosulfonic acid amideorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativesorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary amineorganic nitrogen compoundimidolactamamineorganooxygen compound |
|---|
