| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:35 UTC |
|---|
| Update Date | 2025-03-25 00:56:30 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02218895 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H16O4 |
|---|
| Molecular Mass | 284.1049 |
|---|
| SMILES | COc1ccc(C2c3ccccc3C(C(=O)O)C2O)cc1 |
|---|
| InChI Key | ASLJSJIQAZCUOU-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | indanes |
|---|
| Subclass | indanes |
|---|
| Direct Parent | indanes |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acidshydrocarbon derivativesmethoxybenzenesmonocarboxylic acids and derivativesorganic oxidesphenoxy compoundssecondary alcohols |
|---|
| Substituents | alcoholphenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidaromatic homopolycyclic compoundhydroxy acidalkyl aryl ethercarboxylic acid derivativemethoxybenzenebeta-hydroxy acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundanisoleindanesecondary alcoholhydrocarbon derivativephenoxy compoundorganooxygen compound |
|---|
