| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:38 UTC |
|---|
| Update Date | 2025-03-25 00:56:31 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02218989 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H16O4 |
|---|
| Molecular Mass | 320.1049 |
|---|
| SMILES | COc1ccc(C2CC(=O)c3ccc4ccc(O)cc4c3O2)cc1 |
|---|
| InChI Key | CEYRESZCKJZBES-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | o-methylated flavonoids |
|---|
| Direct Parent | 4'-o-methylated flavonoids |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesaryl alkyl ketonesbenzochromonesflavanoneshydrocarbon derivativesmethoxybenzenesnaphthols and derivativesnaphthopyransorganic oxidesoxacyclic compoundsphenoxy compoundspyrans |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetheraryl alkyl ketone1-benzopyranflavanoneflavan1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherketoneorganic oxidechromonearomatic heteropolycyclic compoundbenzochromonechromane2-naphtholorganoheterocyclic compoundbenzopyranmethoxybenzeneoxacyclenaphthopyrannaphthaleneorganic oxygen compoundpyrananisole4p-methoxyflavonoid-skeletonhydrocarbon derivativebenzenoidphenoxy compoundorganooxygen compoundaryl ketone |
|---|
