| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:39 UTC |
|---|
| Update Date | 2025-03-25 00:56:32 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02219035 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C34H36O25 |
|---|
| Molecular Mass | 844.1546 |
|---|
| SMILES | COc1ccc(C2CC(=O)c3c(cc(OC4OC(C(=O)O)C(O)C(O)C4O)cc3OC3OC(C(=O)O)C(O)C(O)C3O)O2)cc1OC1OC(C(=O)O)C(O)C(C(=O)O)O1 |
|---|
| InChI Key | MCBZUGNPOXTHBJ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | flavonoids |
|---|
| Subclass | flavonoid glycosides |
|---|
| Direct Parent | flavonoid-7-o-glucuronides |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,3-dioxanes4'-o-methylated flavonoidsacetalsalkyl aryl ethersanisolesaryl alkyl ketonesbeta hydroxy acids and derivativescarboxylic acid orthoesterscarboxylic acidschromonesflavanonesflavonoid-7-o-glycosidesglucuronic acid derivativeshydrocarbon derivativesmethoxybenzenesmonosaccharideso-glucuronidesorganic oxidesortho estersoxacyclic compoundsoxanesphenoxy compoundspyran carboxylic acidssecondary alcoholstetracarboxylic acids and derivatives |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarboxylic acidaryl alkyl ketone1-benzopyranflavanoneo-glucuronidemonosaccharidecarboxylic acid orthoesterpyran carboxylic acidketone1-o-glucuronidebeta-hydroxy acidsaccharideacetalchromoneorthocarboxylic acid derivativeoxaneorganoheterocyclic compoundalcoholbenzopyranmethoxybenzeneanisole4p-methoxyflavonoid-skeletonhydrocarbon derivativephenoxy compoundmeta-dioxanearyl ketonecarbonyl groupetherglucuronic acid or derivativesortho esterflavanalkyl aryl ethercarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundchromaneflavonoid-7-o-glycosidepyran carboxylic acid or derivativestetracarboxylic acid or derivativeshydroxy acidoxacycleorganic oxygen compoundpyranflavonoid-7-o-glucuronidesecondary alcoholbenzenoidorganooxygen compound |
|---|