| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:42 UTC |
|---|
| Update Date | 2025-03-25 00:56:33 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02219175 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H14N2O3 |
|---|
| Molecular Mass | 270.1004 |
|---|
| SMILES | COc1ccc2cc(C3CC(=O)NC(=O)N3)ccc2c1 |
|---|
| InChI Key | DZPJGIBIDIXKHP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | naphthalenes |
|---|
| Subclass | naphthalenes |
|---|
| Direct Parent | naphthalenes |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativesdiazinanesdicarboximideshydrocarbon derivativesn-acyl ureasorganic carbonic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrimidones |
|---|
| Substituents | phenol ethercarbonyl groupetherpyrimidonealkyl aryl ethercarboxylic acid derivativepyrimidine1,3-diazinaneorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compounddicarboximideureideorganoheterocyclic compoundn-acyl ureacarbonic acid derivativeazacyclenaphthaleneorganic oxygen compoundanisolehydrocarbon derivativeorganic nitrogen compoundorganooxygen compound |
|---|
