| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:44 UTC |
|---|
| Update Date | 2025-03-25 00:56:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02219225 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H11N3O3 |
|---|
| Molecular Mass | 209.08 |
|---|
| SMILES | COc1ccc(O)c(C(=O)N=C(N)N)c1 |
|---|
| InChI Key | FUODMIQKVKDLKT-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | methoxyphenols |
|---|
| Direct Parent | methoxyphenols |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids4-alkoxyphenolsalkyl aryl ethersanisolesbenzoic acids and derivativesbenzoyl derivativescarboximidamidescarboxylic acids and derivativesguanidineshydrocarbon derivativesmethoxybenzenesorganic oxidesorganopnictogen compoundsphenoxy compoundspropargyl-type 1,3-dipolar organic compoundssalicylamidesvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetherguanidinebenzoylmethoxyphenol1-hydroxy-2-unsubstituted benzenoidalkyl aryl ethercarboxylic acid derivativepropargyl-type 1,3-dipolar organic compoundorganic oxideorganonitrogen compoundorganopnictogen compound4-alkoxyphenolbenzoic acid or derivativesorganic 1,3-dipolar compoundcarboximidamidemethoxybenzenesalicylamidearomatic homomonocyclic compoundvinylogous acidorganic oxygen compoundsalicylic acid or derivativesanisolehydrocarbon derivativeorganic nitrogen compoundphenoxy compoundorganooxygen compound |
|---|
