| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:44 UTC |
|---|
| Update Date | 2025-03-25 00:56:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02219251 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H26N2O2 |
|---|
| Molecular Mass | 314.1994 |
|---|
| SMILES | COc1ccc2c(c1)C13CCN(C(C)=O)CC1C(C2)N(C)CC3 |
|---|
| InChI Key | SNNHNVUTPCGORL-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzazocines |
|---|
| Direct Parent | benzazocines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | acetamidesalkyl aryl ethersamino acids and derivativesanisolesazacyclic compoundscarbonyl compoundscarboxylic acids and derivativeshydrocarbon derivativesn-acylpiperidinesnaphthyridinesorganic oxidesorganopnictogen compoundstertiary carboxylic acid amidestetralinstrialkylamines |
|---|
| Substituents | tetralinphenol ethercarbonyl groupetheramino acid or derivativesalkyl aryl ethercarboxylic acid derivativeorganic oxidediazanaphthalenearomatic heteropolycyclic compoundtertiary carboxylic acid amideorganonitrogen compoundorganopnictogen compoundpiperidinetertiary amineorganoheterocyclic compoundacetamidenaphthyridineazacycletertiary aliphatic aminecarboxamide groupn-acyl-piperidineorganic oxygen compoundanisolebenzazocinehydrocarbon derivativeorganic nitrogen compoundamineorganooxygen compound |
|---|
