| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:45 UTC |
|---|
| Update Date | 2025-03-25 00:56:34 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02219272 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H14O4S |
|---|
| Molecular Mass | 230.0613 |
|---|
| SMILES | COCCc1ccc(OS(C)(=O)=O)cc1 |
|---|
| InChI Key | FVNYUMSGDPKOTI-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenols |
|---|
| Subclass | tyrosols and derivatives |
|---|
| Direct Parent | tyrosols and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | dialkyl ethershydrocarbon derivativesmethanesulfonatesorganic oxidesorganosulfonic acid estersphenoxy compoundssulfonic acid esterssulfonyls |
|---|
| Substituents | organosulfonic acid or derivativesmonocyclic benzene moietyetherorganosulfur compounddialkyl etherorganosulfonic acid esteraromatic homomonocyclic compoundsulfonic acid estermethanesulfonateorganic oxidesulfonylorganic oxygen compoundorganic sulfonic acid or derivativeshydrocarbon derivativetyrosol derivativephenoxy compoundorganooxygen compound |
|---|
