| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:50 UTC |
|---|
| Update Date | 2025-03-25 00:56:35 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02219474 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H10O6S2 |
|---|
| Molecular Mass | 277.9919 |
|---|
| SMILES | COc1cc(CC(=O)S)ccc1OS(=O)(=O)O |
|---|
| InChI Key | SWOMEPBCCCJFLW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | organic sulfuric acids and derivatives |
|---|
| Subclass | arylsulfates |
|---|
| Direct Parent | phenylsulfates |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersalkylthiolsanisolescarbodithioic acidscarbonyl compoundscarbothioic s-acidscarboxylic acids and derivativeshydrocarbon derivativesmethoxybenzenesorganic oxidesorganosulfur compoundsphenoxy compoundssulfuric acid monoestersthiocarboxylic acids and derivativesthiolactones |
|---|
| Substituents | phenol ethermonocyclic benzene moietysulfuric acid monoestercarbonyl groupetheralkyl aryl etherorganosulfur compoundcarboxylic acid derivativephenylsulfateorganic oxidethiolactonethiocarboxylic acid or derivativescarbodithioic acidmethoxybenzenecarbothioic s-acidaromatic homomonocyclic compoundorganic oxygen compoundanisolesulfate-esterhydrocarbon derivativebenzenoidphenoxy compoundsulfuric acid esteralkylthiolorganooxygen compound |
|---|
