| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:52 UTC |
|---|
| Update Date | 2025-03-25 00:56:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02219543 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H15N3O2 |
|---|
| Molecular Mass | 281.1164 |
|---|
| SMILES | COc1cc2nc(-c3ccccc3)nc(N)c2cc1OC |
|---|
| InChI Key | MOTMKXNVKSKZHV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | diazanaphthalenes |
|---|
| Subclass | benzodiazines |
|---|
| Direct Parent | quinazolinamines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersanisolesazacyclic compoundsbenzene and substituted derivativesdiazanaphthalenesheteroaromatic compoundshydrocarbon derivativesimidolactamsorganopnictogen compoundsprimary aminespyrimidines and pyrimidine derivatives |
|---|
| Substituents | phenol ethermonocyclic benzene moietyetherazacycleheteroaromatic compoundalkyl aryl etherpyrimidineorganic oxygen compoundaromatic heteropolycyclic compoundanisoleorganonitrogen compoundquinazolinamineorganopnictogen compoundhydrocarbon derivativebenzenoidprimary amineorganic nitrogen compoundimidolactamamineorganooxygen compound |
|---|
