| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:52 UTC |
|---|
| Update Date | 2025-03-25 00:56:36 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02219547 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H20NO4+ |
|---|
| Molecular Mass | 314.1387 |
|---|
| SMILES | COc1cc2c[n+](C)c3cc(OC)c(OC)cc3c2cc1OC |
|---|
| InChI Key | QKLFIEGYBIUROS-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | quinolines and derivatives |
|---|
| Subclass | benzoquinolines |
|---|
| Direct Parent | phenanthridines and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesalkyl aryl ethersanisolesazacyclic compoundsheteroaromatic compoundshydrocarbon derivativesisoquinolines and derivativesmethylpyridinesorganic cationsorganonitrogen compoundsorganopnictogen compoundspolyhalopyridines |
|---|
| Substituents | phenol etheretherpolyhalopyridinealkyl aryl etheraromatic heteropolycyclic compoundorganonitrogen compoundorganopnictogen compound2-halopyridineorganic cationazacycleheteroaromatic compoundmethylpyridinepyridineorganic oxygen compoundanisoleisoquinolinehydrocarbon derivativebenzenoidphenanthridineorganic nitrogen compoundorganooxygen compound |
|---|