| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:52 UTC |
|---|
| Update Date | 2025-03-25 00:56:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02219549 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O6 |
|---|
| Molecular Mass | 286.0477 |
|---|
| SMILES | COc1cc(=O)oc2oc(-c3ccc(O)cc3)cc(=O)c12 |
|---|
| InChI Key | BMIIQYGRVHMECV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyranones and derivatives |
|---|
| Direct Parent | pyranones and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersbenzene and substituted derivativesheteroaromatic compoundshydrocarbon derivativeslactonesorganic oxidesoxacyclic compoundsvinylogous esters |
|---|
| Substituents | monocyclic benzene moietyethervinylogous esterheteroaromatic compound1-hydroxy-2-unsubstituted benzenoidalkyl aryl etherlactoneoxacycleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundpyranonephenolhydrocarbon derivativebenzenoidorganooxygen compound |
|---|
