| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:53 UTC |
|---|
| Update Date | 2025-03-25 00:56:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02219600 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H25NO5 |
|---|
| Molecular Mass | 335.1733 |
|---|
| SMILES | COc1ccc(C(O)C(=O)OC2CC3CCC(C2)N3C)cc1OC |
|---|
| InChI Key | IOSLOXXJVSLLPV-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | methoxybenzenes |
|---|
| Direct Parent | dimethoxybenzenes |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | alkyl aryl ethersamino acids and derivativesanisolesaromatic alcoholsazacyclic compoundscarbonyl compoundscarboxylic acid estershydrocarbon derivativesmonocarboxylic acids and derivativesn-alkylpyrrolidinesorganic oxidesorganopnictogen compoundsphenoxy compoundspiperidinessecondary alcoholstrialkylaminestropane alkaloids |
|---|
| Substituents | aromatic alcoholphenol ethercarbonyl groupetheramino acid or derivativesalkyl aryl ethercarboxylic acid derivativedimethoxybenzeneorganic oxidearomatic heteropolycyclic compoundo-dimethoxybenzeneorganonitrogen compoundorganopnictogen compoundpyrrolidinepiperidinetertiary amineorganoheterocyclic compoundalcoholazacyclen-alkylpyrrolidinetertiary aliphatic aminemonocarboxylic acid or derivativesorganic oxygen compoundanisolecarboxylic acid estersecondary alcoholhydrocarbon derivativeorganic nitrogen compoundphenoxy compoundtropane alkaloidamineorganooxygen compound |
|---|
