| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:54 UTC |
|---|
| Update Date | 2025-03-25 00:56:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02219605 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H16O7 |
|---|
| Molecular Mass | 320.0896 |
|---|
| SMILES | COc1cc(O)cc(O)c1C(=O)CCc1c(O)cc(O)cc1O |
|---|
| InChI Key | BCXMEMXGMOPVDP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | linear 1,3-diarylpropanoids |
|---|
| Subclass | chalcones and dihydrochalcones |
|---|
| Direct Parent | 2'-hydroxy-dihydrochalcones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsalkyl aryl ethersalkyl-phenylketonesanisolesaryl alkyl ketonesbenzoyl derivativesbutyrophenonescinnamylphenolshydrocarbon derivativesmethoxybenzenesmethoxyphenolsorganic oxidesphenoxy compoundsphloroglucinols and derivativesresorcinolsvinylogous acids |
|---|
| Substituents | phenol ethermonocyclic benzene moietyether2'-hydroxy-dihydrochalconearyl alkyl ketonemethoxyphenolbenzoyl1-hydroxy-2-unsubstituted benzenoidcinnamylphenolalkyl aryl etherresorcinolketonephloroglucinol derivativeorganic oxidebenzenetriol1-hydroxy-4-unsubstituted benzenoidmethoxybenzenephenylketonebutyrophenonearomatic homomonocyclic compoundvinylogous acidorganic oxygen compoundanisolephenolhydrocarbon derivativebenzenoidphenoxy compoundalkyl-phenylketoneorganooxygen compoundaryl ketone |
|---|