| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:55 UTC |
|---|
| Update Date | 2025-03-25 00:56:37 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02219644 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H21NO4 |
|---|
| Molecular Mass | 315.1471 |
|---|
| SMILES | COc1cc2c(cc1O)CCN(C)C2C(O)c1ccc(O)cc1 |
|---|
| InChI Key | QAUDWZZHDVOPLW-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | isoquinolines and derivatives |
|---|
| Subclass | benzylisoquinolines |
|---|
| Direct Parent | benzylisoquinolines |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1,2-aminoalcohols1-hydroxy-2-unsubstituted benzenoidsalkyl aryl ethersanisolesaralkylaminesaromatic alcoholsazacyclic compoundsbenzene and substituted derivativeshydrocarbon derivativesorganopnictogen compoundssecondary alcoholstetrahydroisoquinolinestrialkylamines |
|---|
| Substituents | aromatic alcoholphenol ethermonocyclic benzene moietyether1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheraralkylaminearomatic heteropolycyclic compoundorganonitrogen compoundtetrahydroisoquinolineorganopnictogen compoundtertiary aminealcoholazacycle1,2-aminoalcoholtertiary aliphatic aminebenzylisoquinolineorganic oxygen compoundanisolesecondary alcoholphenolhydrocarbon derivativebenzenoidorganic nitrogen compoundamineorganooxygen compound |
|---|