| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:56 UTC |
|---|
| Update Date | 2025-03-25 00:56:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02219685 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H12O4 |
|---|
| Molecular Mass | 268.0736 |
|---|
| SMILES | COc1cc2c(c3c1ccc1cc(O)ccc13)OCO2 |
|---|
| InChI Key | SJHZXTIFDKDDFZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | phenanthrenes and derivatives |
|---|
| Subclass | phenanthrols |
|---|
| Direct Parent | phenanthrols |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoidsacetalsalkyl aryl ethersanisolesbenzodioxoleshydrocarbon derivativesnaphthols and derivativesoxacyclic compounds |
|---|
| Substituents | phenol etheretherphenanthrol1-hydroxy-2-unsubstituted benzenoidalkyl aryl etheroxacyclenaphthaleneorganic oxygen compoundacetalaromatic heteropolycyclic compoundanisolehydrocarbon derivative2-naphtholorganoheterocyclic compoundorganooxygen compoundbenzodioxole |
|---|