| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:57 UTC |
|---|
| Update Date | 2025-03-25 00:56:38 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02219725 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H14O4 |
|---|
| Molecular Mass | 270.0892 |
|---|
| SMILES | COC(=O)c1ccccc1C(=O)Oc1ccc(C)cc1 |
|---|
| InChI Key | KRCCMOXTSLDINP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | depsides and depsidones |
|---|
| Subclass | depsides and depsidones |
|---|
| Direct Parent | depsides and depsidones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | benzoic acid estersbenzoyl derivativesdicarboxylic acids and derivativeshydrocarbon derivativesmethyl estersorganic oxidesorganooxygen compoundsphenol estersphenoxy compoundstoluenes |
|---|
| Substituents | monocyclic benzene moietybenzoylbenzoic acid or derivativesbenzoate estercarboxylic acid derivativearomatic homomonocyclic compoundorganic oxidemethyl esterorganic oxygen compoundcarboxylic acid esterphenol esterdicarboxylic acid or derivativeshydrocarbon derivativebenzenoidphenoxy compoundtolueneorganooxygen compounddepside backbone |
|---|
