| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:58 UTC |
|---|
| Update Date | 2025-03-25 00:56:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02219787 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C11H19N2O2+ |
|---|
| Molecular Mass | 211.1441 |
|---|
| SMILES | C[N+](C)(C)c1ccc(C(O)CN)cc1O |
|---|
| InChI Key | GVXKVUBWWCKYGI-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | aniline and substituted anilines |
|---|
| Direct Parent | aniline and substituted anilines |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaminesaromatic alcoholshydrocarbon derivativesmonoalkylaminesorganic cationsorganic saltsorganopnictogen compoundsquaternary ammonium saltssecondary alcoholso-aminophenols |
|---|
| Substituents | aromatic alcoholalcoholaniline or substituted anilinesquaternary ammonium saltaminophenol1-hydroxy-2-unsubstituted benzenoid1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundorganic oxygen compoundorganonitrogen compoundsecondary alcoholorganopnictogen compoundphenolhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic cationo-aminophenolorganic saltamineorganooxygen compound |
|---|
