| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:59 UTC |
|---|
| Update Date | 2025-03-25 00:56:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02219804 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C20H20O5 |
|---|
| Molecular Mass | 340.1311 |
|---|
| SMILES | COC1=C(O)C(Cc2cccc(O)c2)C(Cc2cccc(O)c2)C1=O |
|---|
| InChI Key | MBUKMJBVITWLBB-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | phenylpropanoids and polyketides |
|---|
| Class | diarylheptanoids |
|---|
| Subclass | linear diarylheptanoids |
|---|
| Direct Parent | linear diarylheptanoids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsbenzene and substituted derivativescyclic ketoneshydrocarbon derivativesorganic oxidesvinylogous acids |
|---|
| Substituents | monocyclic benzene moietycarbonyl group1-hydroxy-2-unsubstituted benzenoidcyclic ketone1-hydroxy-4-unsubstituted benzenoidketonearomatic homomonocyclic compoundvinylogous acidorganic oxideorganic oxygen compoundphenollinear 1,7-diphenylheptane skeletonhydrocarbon derivativebenzenoidorganooxygen compound |
|---|