| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:07:59 UTC |
|---|
| Update Date | 2025-03-25 00:56:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02219825 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C14H25N2+ |
|---|
| Molecular Mass | 221.2012 |
|---|
| SMILES | C[N+](C)(C)CCCCC(N)c1ccccc1 |
|---|
| InChI Key | LPBZYESFMCLTBG-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzene and substituted derivatives |
|---|
| Direct Parent | benzene and substituted derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | amineshydrocarbon derivativesmonoalkylaminesorganic cationsorganic saltsorganopnictogen compoundstetraalkylammonium salts |
|---|
| Substituents | monocyclic benzene moietytetraalkylammonium saltquaternary ammonium saltaromatic homomonocyclic compoundorganonitrogen compoundorganopnictogen compoundhydrocarbon derivativeprimary aliphatic amineorganic nitrogen compoundorganic cationorganic saltamine |
|---|
