| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:01 UTC |
|---|
| Update Date | 2025-03-25 00:56:39 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02219892 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H24O4 |
|---|
| Molecular Mass | 292.1675 |
|---|
| SMILES | COC(=O)C1OC(Oc2cccc(C)c2)C(C)C(C)C1C |
|---|
| InChI Key | YEHYHJCAYMJMEY-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organoheterocyclic compounds |
|---|
| Class | pyrans |
|---|
| Subclass | pyran carboxylic acids and derivatives |
|---|
| Direct Parent | pyran carboxylic acids |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | acetalscarbonyl compoundshydrocarbon derivativesmethyl estersmonocarboxylic acids and derivativesorganic oxidesoxacyclic compoundsoxanesphenol ethersphenoxy compoundstoluenes |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl grouppyran carboxylic acid or derivativesaromatic heteromonocyclic compoundcarboxylic acid derivativeoxacycleorganic oxidemonocarboxylic acid or derivativesmethyl esterorganic oxygen compoundacetalcarboxylic acid esterhydrocarbon derivativebenzenoidphenoxy compoundoxanetolueneorganooxygen compound |
|---|