| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:02 UTC |
|---|
| Update Date | 2025-03-25 00:56:40 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02219947 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C19H28O |
|---|
| Molecular Mass | 272.214 |
|---|
| SMILES | Cc1cc2c(c(C)c1O)C1(C)CCCC(C)(C)C1CC2 |
|---|
| InChI Key | KBZNFHPPQLICHX-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | prenol lipids |
|---|
| Subclass | diterpenoids |
|---|
| Direct Parent | diterpenoids |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | hydrocarbon derivativesorganooxygen compoundsphenanthrenes and derivativestetralins |
|---|
| Substituents | tetralinphenanthreneorganic oxygen compoundabietane diterpenoidaromatic homopolycyclic compoundhydrocarbon derivativebenzenoidditerpenoidorganooxygen compound |
|---|
