| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:06 UTC |
|---|
| Update Date | 2025-03-25 00:56:41 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02220093 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C18H26N2O6S2 |
|---|
| Molecular Mass | 430.1232 |
|---|
| SMILES | CS(=O)CCCCNC(SCC(NC(=O)Cc1ccccc1)C(=O)O)C(=O)O |
|---|
| InChI Key | UJEBFHQGZTVUPQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | n-acyl-alpha amino acids |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | alpha amino acidsamino acidscarbonyl compoundscarboxylic acidscysteine and derivativesdialkylaminesdialkylthioethersdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganopnictogen compoundsphenylacetamidessecondary carboxylic acid amidessulfenyl compoundssulfinyl compoundssulfoxidesthiohemiaminal derivatives |
|---|
| Substituents | monocyclic benzene moietycarbonyl groupcarboxylic acidamino acidorganosulfur compoundorganic oxidesulfinyl compoundorganonitrogen compoundalpha-amino acidhemithioaminalorganopnictogen compoundphenylacetamidesecondary aliphatic aminesulfenyl compoundn-acyl-alpha-amino aciddialkylthioethersecondary aminecarboxamide grouparomatic homomonocyclic compoundsecondary carboxylic acid amideorganic oxygen compoundthioethercysteine or derivativessulfoxidedicarboxylic acid or derivativeshydrocarbon derivativebenzenoidorganic nitrogen compoundorganooxygen compoundamine |
|---|