| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:09 UTC |
|---|
| Update Date | 2025-03-25 00:56:42 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02220205 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C24H26O9 |
|---|
| Molecular Mass | 458.1577 |
|---|
| SMILES | COc1cccc(CC2COC(=O)C2Cc2cccc(OC3OC(C(=O)O)C(O)C3O)c2)c1 |
|---|
| InChI Key | YUQOXEQASNYDAZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lignans, neolignans and related compounds |
|---|
| Class | lignan glycosides |
|---|
| Subclass | lignan glycosides |
|---|
| Direct Parent | lignan glycosides |
|---|
| Geometric Descriptor | aromatic heteromonocyclic compounds |
|---|
| Alternative Parents | 1,2-diolsacetalsalkyl aryl ethersanisolesbeta hydroxy acids and derivativescarbonyl compoundscarboxylic acid esterscarboxylic acidsdibenzylbutyrolactone lignansdicarboxylic acids and derivativesgamma butyrolactoneshydrocarbon derivativeslignan lactonesmethoxybenzenesmonosaccharidesorganic oxidesoxacyclic compoundsphenoxy compoundssecondary alcoholstetrahydrofurans |
|---|
| Substituents | phenol ethermonocyclic benzene moietycarbonyl groupethercarboxylic acidaromatic heteromonocyclic compoundlignan glycosidedibenzylbutyrolactonemonosaccharidealkyl aryl ethercarboxylic acid derivativelignan lactonelactonebeta-hydroxy acidsaccharideorganic oxideacetal9,9p-epoxylignanorganoheterocyclic compound1,2-diolalcoholtetrahydrofuranhydroxy acidmethoxybenzenegamma butyrolactoneoxacycleorganic oxygen compoundanisolecarboxylic acid esterfuranoid lignansecondary alcoholdicarboxylic acid or derivativeshydrocarbon derivativetetrahydrofuran lignanbenzenoidphenoxy compoundorganooxygen compound |
|---|
