| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:09 UTC |
|---|
| Update Date | 2025-03-25 00:56:43 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02220231 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C17H13NO4 |
|---|
| Molecular Mass | 295.0845 |
|---|
| SMILES | COc1ccc2nccc(Oc3ccc(C(=O)O)cc3)c2c1 |
|---|
| InChI Key | XMMOQQNBIACYOA-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic oxygen compounds |
|---|
| Class | organooxygen compounds |
|---|
| Subclass | ethers |
|---|
| Direct Parent | diarylethers |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | 2-halopyridinesalkyl aryl ethersanisolesazacyclic compoundsbenzoic acidsbenzoyl derivativescarboxylic acidsheteroaromatic compoundshydrocarbon derivativeshydroxypyridinesmethylpyridinesmonocarboxylic acids and derivativesorganic oxidesorganonitrogen compoundsorganopnictogen compoundsphenoxy compoundspolyhalopyridinesquinolines and derivatives |
|---|
| Substituents | diaryl etherphenol ethermonocyclic benzene moietycarboxylic acidpolyhalopyridinebenzoylalkyl aryl ethercarboxylic acid derivativeorganic oxidearomatic heteropolycyclic compoundorganonitrogen compoundquinolineorganopnictogen compound2-halopyridinebenzoic acidorganoheterocyclic compoundazacycleheteroaromatic compoundhydroxypyridinebenzoic acid or derivativesmethylpyridinemonocarboxylic acid or derivativespyridineanisolehydrocarbon derivativebenzenoidorganic nitrogen compoundphenoxy compound |
|---|
