| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:14 UTC |
|---|
| Update Date | 2025-03-25 00:56:44 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02220418 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H28NO4+ |
|---|
| Molecular Mass | 286.2013 |
|---|
| SMILES | C[N+](C)(C)C(CCC(=O)O)OC(=O)CCCCC1CC1 |
|---|
| InChI Key | IHWJKPBHHJVIIJ-UHFFFAOYSA-O |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | lipids and lipid-like molecules |
|---|
| Class | fatty acyls |
|---|
| Subclass | fatty acids and conjugates |
|---|
| Direct Parent | carbocyclic fatty acids |
|---|
| Geometric Descriptor | aliphatic homomonocyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acid esterscarboxylic acidsdicarboxylic acids and derivativesfatty acid estershydrocarbon derivativesorganic cationsorganic oxidesorganic saltsorganonitrogen compoundsorganopnictogen compoundsshort-chain hydroxy acids and derivativestetraalkylammonium salts |
|---|
| Substituents | carbocyclic fatty acidcarbonyl groupcarboxylic acidshort-chain hydroxy acidtetraalkylammonium saltcarboxylic acid derivativefatty acid esterorganic oxideorganic oxygen compoundcarboxylic acid esterorganonitrogen compoundaliphatic homomonocyclic compounddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativeorganic nitrogen compoundorganic cationorganic saltorganooxygen compound |
|---|
