| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:19 UTC |
|---|
| Update Date | 2025-03-25 00:56:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02220607 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C15H10O4 |
|---|
| Molecular Mass | 254.0579 |
|---|
| SMILES | O=C(O)c1c(O)ccc2cc3c(O)cccc3cc12 |
|---|
| InChI Key | QGEFNJUVXPNVKP-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | anthracenes |
|---|
| Subclass | anthracenecarboxylic acids and derivatives |
|---|
| Direct Parent | anthracenecarboxylic acids |
|---|
| Geometric Descriptor | aromatic homopolycyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compounds1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidshydrocarbon derivativesmonocarboxylic acids and derivativesnaphthalenecarboxylic acidsnaphthols and derivativesorganic oxidesorganooxygen compoundssalicylic acid and derivativesvinylogous acids |
|---|
| Substituents | carboxylic acid1-hydroxy-2-unsubstituted benzenoidaromatic homopolycyclic compound1-naphthalenecarboxylic acid1-hydroxy-4-unsubstituted benzenoidcarboxylic acid derivativeanthracene carboxylic acidhydroxybenzoic acidvinylogous acidorganic oxidemonocarboxylic acid or derivativesorganic oxygen compoundsalicylic acid or derivatives1-naphthalenecarboxylic acid or derivativeshydrocarbon derivative1-naphthol1-carboxy-2-haloaromatic compound2-naphtholorganooxygen compound |
|---|
