| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:19 UTC |
|---|
| Update Date | 2025-03-25 00:56:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02220621 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C9H5F3O5 |
|---|
| Molecular Mass | 250.0089 |
|---|
| SMILES | O=C(O)c1cc(C(=O)O)c(O)c(C(F)(F)F)c1 |
|---|
| InChI Key | SCMYXPGCBPSOJQ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzoic acids and derivatives |
|---|
| Direct Parent | m-phthalic acid and derivatives |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-carboxy-2-haloaromatic compoundsalkyl fluoridesbenzoic acidsbenzoyl derivativesdicarboxylic acids and derivativeshydrocarbon derivativesorganic oxidesorganofluoridesorganooxygen compoundsphenolssalicylic acidstrifluoromethylbenzenesvinylogous acids |
|---|
| Substituents | carboxylic acidbenzoylsalicylic acidcarboxylic acid derivativeorganohalogen compoundorganic oxidemeta_phthalic_acidalkyl halide1-carboxy-2-haloaromatic compoundbenzoic acidtrifluoromethylbenzenealkyl fluorideorganofluoridehydroxybenzoic acidaromatic homomonocyclic compoundvinylogous acidorganic oxygen compoundsalicylic acid or derivativesdicarboxylic acid or derivativesphenolhydrocarbon derivativeorganooxygen compound |
|---|