| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:20 UTC |
|---|
| Update Date | 2025-03-25 00:56:46 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02220668 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C10H8N2O4 |
|---|
| Molecular Mass | 220.0484 |
|---|
| SMILES | O=C(O)Cn1nc(C(=O)O)c2ccccc21 |
|---|
| InChI Key | YBFLJEAHNQMJFZ-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | amino acids, peptides, and analogues |
|---|
| Direct Parent | alpha amino acids and derivatives |
|---|
| Geometric Descriptor | aromatic heteropolycyclic compounds |
|---|
| Alternative Parents | azacyclic compoundsbenzenoidscarbonyl compoundscarboxylic acidsdicarboxylic acids and derivativesheteroaromatic compoundshydrocarbon derivativesindazolesorganic oxidesorganonitrogen compoundsorganopnictogen compoundspyrazoles |
|---|
| Substituents | carbonyl groupcarboxylic acidazacycleindazoleheteroaromatic compoundalpha-amino acid or derivativespyrazoleorganic oxideorganic oxygen compoundaromatic heteropolycyclic compoundorganonitrogen compounddicarboxylic acid or derivativesorganopnictogen compoundhydrocarbon derivativebenzenoidorganic nitrogen compoundbenzopyrazoleorganoheterocyclic compoundorganooxygen compoundazole |
|---|
