| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:22 UTC |
|---|
| Update Date | 2025-03-25 00:56:47 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02220713 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C8H12O6S2 |
|---|
| Molecular Mass | 268.0075 |
|---|
| SMILES | O=C(O)CCSSC(CCC(=O)O)C(=O)O |
|---|
| InChI Key | IQLDRPREUNPGDC-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | organic acids and derivatives |
|---|
| Class | carboxylic acids and derivatives |
|---|
| Subclass | tricarboxylic acids and derivatives |
|---|
| Direct Parent | tricarboxylic acids and derivatives |
|---|
| Geometric Descriptor | aliphatic acyclic compounds |
|---|
| Alternative Parents | carbonyl compoundscarboxylic acidsdialkyldisulfidesfatty acylshydrocarbon derivativesorganic oxidessulfenyl compoundsthia fatty acids |
|---|
| Substituents | fatty acylaliphatic acyclic compoundcarbonyl groupcarboxylic acidsulfenyl compoundtricarboxylic acid or derivativesorganosulfur compounddialkyldisulfideorganic oxidethia fatty acidorganic oxygen compoundorganic disulfidehydrocarbon derivativeorganooxygen compound |
|---|