| Record Information |
|---|
| HMDB Status | Not Available |
|---|
| Creation Date | 2024-02-21 15:08:24 UTC |
|---|
| Update Date | 2025-03-25 00:56:48 UTC |
|---|
| HMDB ID | Not Available |
|---|
| Metabolite Identification |
|---|
| DeepMet ID | DMID02220799 |
|---|
| Frequency | 0.5 |
|---|
| Structure | |
|---|
| Chemical Formula | C16H14O7 |
|---|
| Molecular Mass | 318.074 |
|---|
| SMILES | O=C(O)CCc1cccc(O)c1C(=O)c1c(O)cc(O)cc1O |
|---|
| InChI Key | DVQCZUULZPCMFR-UHFFFAOYSA-N |
|---|
| Chemical Taxonomy |
|---|
| Kingdom | organic compounds |
|---|
| Superclass | benzenoids |
|---|
| Class | benzene and substituted derivatives |
|---|
| Subclass | benzophenones |
|---|
| Direct Parent | benzophenones |
|---|
| Geometric Descriptor | aromatic homomonocyclic compounds |
|---|
| Alternative Parents | 1-hydroxy-2-unsubstituted benzenoids1-hydroxy-4-unsubstituted benzenoidsaryl ketonesaryl-phenylketonesbenzoyl derivativescarboxylic acidsdiphenylmethaneshydrocarbon derivativesmonocarboxylic acids and derivativesorganic oxidesphenylpropanoic acidsphloroglucinols and derivativesvinylogous acids |
|---|
| Substituents | diphenylmethanecarbonyl groupcarboxylic acid3-phenylpropanoic-acidbenzoyl1-hydroxy-2-unsubstituted benzenoidcarboxylic acid derivativebenzophenoneketonephloroglucinol derivativeorganic oxidebenzenetriolaryl-phenylketone1-hydroxy-4-unsubstituted benzenoidaromatic homomonocyclic compoundvinylogous acidmonocarboxylic acid or derivativesorganic oxygen compoundphenolhydrocarbon derivativeorganooxygen compoundaryl ketone |
|---|
